About 5-pentan-3-yl-1,2-dihydropyridazin-2-ium-3-amine
5-pentan-3-yl-1,2-dihydropyridazin-2-ium-3-amine (PubChem CID 144666360) has the molecular formula C9H18N3+
and a molecular weight of 168.26 g/mol. Its IUPAC name is 5-pentan-3-yl-1,2-dihydropyridazin-2-ium-3-amine.
Molecular Properties
| Compound Name | 5-pentan-3-yl-1,2-dihydropyridazin-2-ium-3-amine |
| PubChem CID | 144666360 |
| Molecular Formula | C9H18N3+ |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 5-pentan-3-yl-1,2-dihydropyridazin-2-ium-3-amine |
| SMILES | CCC(CC)C1=CN[NH2+]C(N)=C1 |
| InChI | InChI=1S/C9H17N3/c1-3-7(4-2)8-5-9(10)12-11-6-8/h5-7,11-12H,3-4,10H2,1-2H3/p+1 |
| InChIKey | KSCJXHGPZUQQFJ-UHFFFAOYSA-O |
| XLogP | 0.19 |
| TPSA | 54.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 5-pentan-3-yl-1,2-dihydropyridazin-2-ium-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pentan-3-yl-1,2-dihydropyridazin-2-ium-3-amine?
The IUPAC name of 5-pentan-3-yl-1,2-dihydropyridazin-2-ium-3-amine (CID 144666360) is 5-pentan-3-yl-1,2-dihydropyridazin-2-ium-3-amine.
What is the SMILES notation for 5-pentan-3-yl-1,2-dihydropyridazin-2-ium-3-amine?
The canonical SMILES for 5-pentan-3-yl-1,2-dihydropyridazin-2-ium-3-amine is CCC(CC)C1=CN[NH2+]C(N)=C1.
What is the InChIKey of 5-pentan-3-yl-1,2-dihydropyridazin-2-ium-3-amine?
The InChIKey is KSCJXHGPZUQQFJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H17N3/c1-3-7(4-2)8-5-9(10)12-11-6-8/h5-7,11-12H,3-4,10H2,1-2H3/p+1.
What are the key properties of 5-pentan-3-yl-1,2-dihydropyridazin-2-ium-3-amine?
5-pentan-3-yl-1,2-dihydropyridazin-2-ium-3-amine has a molecular weight of 168.26 g/mol, XLogP of 0.19, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pentan-3-yl-1,2-dihydropyridazin-2-ium-3-amine is sourced from PubChem (CID 144666360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).