About 7-bromo-2,5-dimethyl-4aH-1,5-naphthyridine
7-bromo-2,5-dimethyl-4aH-1,5-naphthyridine (PubChem CID 144666416) has the molecular formula C10H11BrN2
and a molecular weight of 239.12 g/mol. Its IUPAC name is 7-bromo-2,5-dimethyl-4aH-1,5-naphthyridine.
Molecular Properties
| Compound Name | 7-bromo-2,5-dimethyl-4aH-1,5-naphthyridine |
| PubChem CID | 144666416 |
| Molecular Formula | C10H11BrN2 |
| Molecular Weight | 239.12 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 7-bromo-2,5-dimethyl-4aH-1,5-naphthyridine |
| SMILES | CC1=NC2=CC(Br)=CN(C)C2C=C1 |
| InChI | InChI=1S/C10H11BrN2/c1-7-3-4-10-9(12-7)5-8(11)6-13(10)2/h3-6,10H,1-2H3 |
| InChIKey | FCMYQZYHEXKXHP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.12 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-2,5-dimethyl-4aH-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2,5-dimethyl-4aH-1,5-naphthyridine?
The IUPAC name of 7-bromo-2,5-dimethyl-4aH-1,5-naphthyridine (CID 144666416) is 7-bromo-2,5-dimethyl-4aH-1,5-naphthyridine.
What is the SMILES notation for 7-bromo-2,5-dimethyl-4aH-1,5-naphthyridine?
The canonical SMILES for 7-bromo-2,5-dimethyl-4aH-1,5-naphthyridine is CC1=NC2=CC(Br)=CN(C)C2C=C1.
What is the InChIKey of 7-bromo-2,5-dimethyl-4aH-1,5-naphthyridine?
The InChIKey is FCMYQZYHEXKXHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN2/c1-7-3-4-10-9(12-7)5-8(11)6-13(10)2/h3-6,10H,1-2H3.
What are the key properties of 7-bromo-2,5-dimethyl-4aH-1,5-naphthyridine?
7-bromo-2,5-dimethyl-4aH-1,5-naphthyridine has a molecular weight of 239.12 g/mol, XLogP of 2.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2,5-dimethyl-4aH-1,5-naphthyridine is sourced from PubChem (CID 144666416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).