About ethane;1-[3-(3-methoxy-3-methylazetidin-1-yl)propyl]-3,4-dimethylpyrazole
ethane;1-[3-(3-methoxy-3-methylazetidin-1-yl)propyl]-3,4-dimethylpyrazole (PubChem CID 144666973) has the molecular formula C15H29N3O
and a molecular weight of 267.42 g/mol. Its IUPAC name is ethane;1-[3-(3-methoxy-3-methylazetidin-1-yl)propyl]-3,4-dimethylpyrazole.
Molecular Properties
| Compound Name | ethane;1-[3-(3-methoxy-3-methylazetidin-1-yl)propyl]-3,4-dimethylpyrazole |
| PubChem CID | 144666973 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | ethane;1-[3-(3-methoxy-3-methylazetidin-1-yl)propyl]-3,4-dimethylpyrazole |
| SMILES | CC.COC1(C)CN(CCCn2cc(C)c(C)n2)C1 |
| InChI | InChI=1S/C13H23N3O.C2H6/c1-11-8-16(14-12(11)2)7-5-6-15-9-13(3,10-15)17-4;1-2/h8H,5-7,9-10H2,1-4H3;1-2H3 |
| InChIKey | LXMFDPYVOYUPTI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;1-[3-(3-methoxy-3-methylazetidin-1-yl)propyl]-3,4-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[3-(3-methoxy-3-methylazetidin-1-yl)propyl]-3,4-dimethylpyrazole?
The IUPAC name of ethane;1-[3-(3-methoxy-3-methylazetidin-1-yl)propyl]-3,4-dimethylpyrazole (CID 144666973) is ethane;1-[3-(3-methoxy-3-methylazetidin-1-yl)propyl]-3,4-dimethylpyrazole.
What is the SMILES notation for ethane;1-[3-(3-methoxy-3-methylazetidin-1-yl)propyl]-3,4-dimethylpyrazole?
The canonical SMILES for ethane;1-[3-(3-methoxy-3-methylazetidin-1-yl)propyl]-3,4-dimethylpyrazole is CC.COC1(C)CN(CCCn2cc(C)c(C)n2)C1.
What is the InChIKey of ethane;1-[3-(3-methoxy-3-methylazetidin-1-yl)propyl]-3,4-dimethylpyrazole?
The InChIKey is LXMFDPYVOYUPTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O.C2H6/c1-11-8-16(14-12(11)2)7-5-6-15-9-13(3,10-15)17-4;1-2/h8H,5-7,9-10H2,1-4H3;1-2H3.
What are the key properties of ethane;1-[3-(3-methoxy-3-methylazetidin-1-yl)propyl]-3,4-dimethylpyrazole?
ethane;1-[3-(3-methoxy-3-methylazetidin-1-yl)propyl]-3,4-dimethylpyrazole has a molecular weight of 267.42 g/mol, XLogP of 2.64, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[3-(3-methoxy-3-methylazetidin-1-yl)propyl]-3,4-dimethylpyrazole is sourced from PubChem (CID 144666973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).