About [[4-(6-chloro-1,5-naphthyridin-3-yl)-2-pyridinyl]-methylboranyl]formonitrile
[[4-(6-chloro-1,5-naphthyridin-3-yl)-2-pyridinyl]-methylboranyl]formonitrile (PubChem CID 144667044) has the molecular formula C15H10BClN4
and a molecular weight of 292.54 g/mol. Its IUPAC name is [[4-(6-chloro-1,5-naphthyridin-3-yl)-2-pyridinyl]-methylboranyl]formonitrile.
Molecular Properties
| Compound Name | [[4-(6-chloro-1,5-naphthyridin-3-yl)-2-pyridinyl]-methylboranyl]formonitrile |
| PubChem CID | 144667044 |
| Molecular Formula | C15H10BClN4 |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | [[4-(6-chloro-1,5-naphthyridin-3-yl)-2-pyridinyl]-methylboranyl]formonitrile |
| SMILES | CB(C#N)c1cc(-c2cnc3ccc(Cl)nc3c2)ccn1 |
| InChI | InChI=1S/C15H10BClN4/c1-16(9-18)14-7-10(4-5-19-14)11-6-13-12(20-8-11)2-3-15(17)21-13/h2-8H,1H3 |
| InChIKey | IUEHLEMYPCHIIT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [[4-(6-chloro-1,5-naphthyridin-3-yl)-2-pyridinyl]-methylboranyl]formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[4-(6-chloro-1,5-naphthyridin-3-yl)-2-pyridinyl]-methylboranyl]formonitrile?
The IUPAC name of [[4-(6-chloro-1,5-naphthyridin-3-yl)-2-pyridinyl]-methylboranyl]formonitrile (CID 144667044) is [[4-(6-chloro-1,5-naphthyridin-3-yl)-2-pyridinyl]-methylboranyl]formonitrile.
What is the SMILES notation for [[4-(6-chloro-1,5-naphthyridin-3-yl)-2-pyridinyl]-methylboranyl]formonitrile?
The canonical SMILES for [[4-(6-chloro-1,5-naphthyridin-3-yl)-2-pyridinyl]-methylboranyl]formonitrile is CB(C#N)c1cc(-c2cnc3ccc(Cl)nc3c2)ccn1.
What is the InChIKey of [[4-(6-chloro-1,5-naphthyridin-3-yl)-2-pyridinyl]-methylboranyl]formonitrile?
The InChIKey is IUEHLEMYPCHIIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BClN4/c1-16(9-18)14-7-10(4-5-19-14)11-6-13-12(20-8-11)2-3-15(17)21-13/h2-8H,1H3.
What are the key properties of [[4-(6-chloro-1,5-naphthyridin-3-yl)-2-pyridinyl]-methylboranyl]formonitrile?
[[4-(6-chloro-1,5-naphthyridin-3-yl)-2-pyridinyl]-methylboranyl]formonitrile has a molecular weight of 292.54 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[4-(6-chloro-1,5-naphthyridin-3-yl)-2-pyridinyl]-methylboranyl]formonitrile is sourced from PubChem (CID 144667044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).