C25H31FN8S — CID 144667087
N-[7-[1-amino-3-[3-[(3S)-3-fluoropyrrolidin-1-yl]propylimino]prop-1-en-2-yl]-1,5-naphthyridin-2-yl]-5-cyclopentyl-1,3,4-thiadiazol-2-amine (PubChem CID 144667087) has the molecular formula C25H31FN8S and a molecular weight of 494.64 g/mol. Its IUPAC name is N-[7-[1-amino-3-[3-[(3S)-3-fluoropyrrolidin-1-yl]propylimino]prop-1-en-2-yl]-1,5-naphthyridin-2-yl]-5-cyclopentyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[7-[1-amino-3-[3-[(3S)-3-fluoropyrrolidin-1-yl]propylimino]prop-1-en-2-yl]-1,5-naphthyridin-2-yl]-5-cyclopentyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 144667087 |
| Molecular Formula | C25H31FN8S |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | N-[7-[1-amino-3-[3-[(3S)-3-fluoropyrrolidin-1-yl]propylimino]prop-1-en-2-yl]-1,5-naphthyridin-2-yl]-5-cyclopentyl-1,3,4-thiadiazol-2-amine |
| SMILES | NC=C(/C=N/CCCN1CC[C@H](F)C1)c1cnc2ccc(Nc3nnc(C4CCCC4)s3)nc2c1 |
| InChI | InChI=1S/C25H31FN8S/c26-20-8-11-34(16-20)10-3-9-28-14-19(13-27)18-12-22-21(29-15-18)6-7-23(30-22)31-25-33-32-24(35-25)17-4-1-2-5-17/h6-7,12-15,17,20H,1-5,8-11,16,27H2,(H,30,31,33)/b19-13?,28-14+/t20-/m0/s1 |
| InChIKey | SNRMAZYDYZVGIJ-QMVYTRBVSA-N |
| XLogP | 4.69 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|