C19H37BrN6 — CID 144667101
(E)-2-bromo-3-imino-N-methyl-3-piperidin-1-ylprop-1-en-1-amine;(Z)-3-imino-N-methyl-3-piperidin-1-ylprop-1-en-1-amine;methane (PubChem CID 144667101) has the molecular formula C19H37BrN6 and a molecular weight of 429.45 g/mol. Its IUPAC name is (E)-2-bromo-3-imino-N-methyl-3-piperidin-1-ylprop-1-en-1-amine;(Z)-3-imino-N-methyl-3-piperidin-1-ylprop-1-en-1-amine;methane.
| Compound Name | (E)-2-bromo-3-imino-N-methyl-3-piperidin-1-ylprop-1-en-1-amine;(Z)-3-imino-N-methyl-3-piperidin-1-ylprop-1-en-1-amine;methane |
|---|---|
| PubChem CID | 144667101 |
| Molecular Formula | C19H37BrN6 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | (E)-2-bromo-3-imino-N-methyl-3-piperidin-1-ylprop-1-en-1-amine;(Z)-3-imino-N-methyl-3-piperidin-1-ylprop-1-en-1-amine;methane |
| SMILES | C.[H]/N=C(C(\Br)=C/NC)/N1CCCCC1.[H]/N=C(\C=C/NC)N1CCCCC1 |
| InChI | InChI=1S/C9H16BrN3.C9H17N3.CH4/c1-12-7-8(10)9(11)13-5-3-2-4-6-13;1-11-6-5-9(10)12-7-3-2-4-8-12;/h7,11-12H,2-6H2,1H3;5-6,10-11H,2-4,7-8H2,1H3;1H4/b8-7+,11-9+;6-5-,10-9+; |
| InChIKey | PDGPNXOLNHSVAA-WKMAXIMQSA-N |
| XLogP | 3.72 |
| TPSA | 78.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|