About 2-[[(5Z)-5-ethylocta-5,7-dien-4-yl]disulfanyl]ethanol
2-[[(5Z)-5-ethylocta-5,7-dien-4-yl]disulfanyl]ethanol (PubChem CID 144667399) has the molecular formula C12H22OS2
and a molecular weight of 246.44 g/mol. Its IUPAC name is 2-[[(5Z)-5-ethylocta-5,7-dien-4-yl]disulfanyl]ethanol.
Molecular Properties
| Compound Name | 2-[[(5Z)-5-ethylocta-5,7-dien-4-yl]disulfanyl]ethanol |
| PubChem CID | 144667399 |
| Molecular Formula | C12H22OS2 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2-[[(5Z)-5-ethylocta-5,7-dien-4-yl]disulfanyl]ethanol |
| SMILES | C=C/C=C(/CC)C(CCC)SSCCO |
| InChI | InChI=1S/C12H22OS2/c1-4-7-11(6-3)12(8-5-2)15-14-10-9-13/h4,7,12-13H,1,5-6,8-10H2,2-3H3/b11-7- |
| InChIKey | XSRWZZYNXLMVJR-XFFZJAGNSA-N |
| XLogP | 4.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(5Z)-5-ethylocta-5,7-dien-4-yl]disulfanyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(5Z)-5-ethylocta-5,7-dien-4-yl]disulfanyl]ethanol?
The IUPAC name of 2-[[(5Z)-5-ethylocta-5,7-dien-4-yl]disulfanyl]ethanol (CID 144667399) is 2-[[(5Z)-5-ethylocta-5,7-dien-4-yl]disulfanyl]ethanol.
What is the SMILES notation for 2-[[(5Z)-5-ethylocta-5,7-dien-4-yl]disulfanyl]ethanol?
The canonical SMILES for 2-[[(5Z)-5-ethylocta-5,7-dien-4-yl]disulfanyl]ethanol is C=C/C=C(/CC)C(CCC)SSCCO.
What is the InChIKey of 2-[[(5Z)-5-ethylocta-5,7-dien-4-yl]disulfanyl]ethanol?
The InChIKey is XSRWZZYNXLMVJR-XFFZJAGNSA-N. The full InChI is InChI=1S/C12H22OS2/c1-4-7-11(6-3)12(8-5-2)15-14-10-9-13/h4,7,12-13H,1,5-6,8-10H2,2-3H3/b11-7-.
What are the key properties of 2-[[(5Z)-5-ethylocta-5,7-dien-4-yl]disulfanyl]ethanol?
2-[[(5Z)-5-ethylocta-5,7-dien-4-yl]disulfanyl]ethanol has a molecular weight of 246.44 g/mol, XLogP of 4.05, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(5Z)-5-ethylocta-5,7-dien-4-yl]disulfanyl]ethanol is sourced from PubChem (CID 144667399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).