C26H42O4 — CID 144667461
(3,5-dimethoxyphenyl)-[3-(methoxymethyl)-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]methanone;ethane (PubChem CID 144667461) has the molecular formula C26H42O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-[3-(methoxymethyl)-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]methanone;ethane.
| Compound Name | (3,5-dimethoxyphenyl)-[3-(methoxymethyl)-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]methanone;ethane |
|---|---|
| PubChem CID | 144667461 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | (3,5-dimethoxyphenyl)-[3-(methoxymethyl)-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-1-yl]methanone;ethane |
| SMILES | CC.COCC1CC(C(=O)c2cc(OC)cc(OC)c2)C2(C)CCCC(C)(C)C2C1 |
| InChI | InChI=1S/C24H36O4.C2H6/c1-23(2)8-7-9-24(3)20(10-16(15-26-4)11-21(23)24)22(25)17-12-18(27-5)14-19(13-17)28-6;1-2/h12-14,16,20-21H,7-11,15H2,1-6H3;1-2H3 |
| InChIKey | RIGWYYKNXZLINE-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |