C35H44N4 — CID 144667720
ethane;4-[(2Z,4E)-5-(ethylaminomethyl)-4-methylhepta-2,4,6-trien-3-yl]-2-[1-[4-(4-methylcyclohexa-1,5-dien-1-yl)-1H-benzimidazol-2-yl]ethenyl]aniline (PubChem CID 144667720) has the molecular formula C35H44N4 and a molecular weight of 520.77 g/mol. Its IUPAC name is ethane;4-[(2Z,4E)-5-(ethylaminomethyl)-4-methylhepta-2,4,6-trien-3-yl]-2-[1-[4-(4-methylcyclohexa-1,5-dien-1-yl)-1H-benzimidazol-2-yl]ethenyl]aniline.
| Compound Name | ethane;4-[(2Z,4E)-5-(ethylaminomethyl)-4-methylhepta-2,4,6-trien-3-yl]-2-[1-[4-(4-methylcyclohexa-1,5-dien-1-yl)-1H-benzimidazol-2-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 144667720 |
| Molecular Formula | C35H44N4 |
| Molecular Weight | 520.77 g/mol |
| Exact Mass | 520.36 |
| IUPAC Name | ethane;4-[(2Z,4E)-5-(ethylaminomethyl)-4-methylhepta-2,4,6-trien-3-yl]-2-[1-[4-(4-methylcyclohexa-1,5-dien-1-yl)-1H-benzimidazol-2-yl]ethenyl]aniline |
| SMILES | C=C/C(CNCC)=C(C)\C(=C/C)c1ccc(N)c(C(=C)c2nc3c(C4=CCC(C)C=C4)cccc3[nH]2)c1.CC |
| InChI | InChI=1S/C33H38N4.C2H6/c1-7-24(20-35-9-3)22(5)27(8-2)26-17-18-30(34)29(19-26)23(6)33-36-31-12-10-11-28(32(31)37-33)25-15-13-21(4)14-16-25;1-2/h7-8,10-13,15-19,21,35H,1,6,9,14,20,34H2,2-5H3,(H,36,37);1-2H3/b24-22+,27-8+; |
| InChIKey | CLZIJBZBBWLTQP-LGHWQBAGSA-N |
| XLogP | 8.73 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.77 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|