C20H25F3N2O — CID 144668108
buta-1,3-diene;ethane;6-methyl-5-[3-(2,2,2-trifluoroethoxy)phenyl]pyridin-2-amine (PubChem CID 144668108) has the molecular formula C20H25F3N2O and a molecular weight of 366.43 g/mol. Its IUPAC name is buta-1,3-diene;ethane;6-methyl-5-[3-(2,2,2-trifluoroethoxy)phenyl]pyridin-2-amine.
| Compound Name | buta-1,3-diene;ethane;6-methyl-5-[3-(2,2,2-trifluoroethoxy)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 144668108 |
| Molecular Formula | C20H25F3N2O |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | buta-1,3-diene;ethane;6-methyl-5-[3-(2,2,2-trifluoroethoxy)phenyl]pyridin-2-amine |
| SMILES | C=CC=C.CC.Cc1nc(N)ccc1-c1cccc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H13F3N2O.C4H6.C2H6/c1-9-12(5-6-13(18)19-9)10-3-2-4-11(7-10)20-8-14(15,16)17;1-3-4-2;1-2/h2-7H,8H2,1H3,(H2,18,19);3-4H,1-2H2;1-2H3 |
| InChIKey | FWOCVDXGFSIQTK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|