C15H26O8 — CID 14466825
2-[2-[2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 14466825) has the molecular formula C15H26O8 and a molecular weight of 334.37 g/mol. Its IUPAC name is 2-[2-[2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[2-[2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 14466825 |
| Molecular Formula | C15H26O8 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2-[2-[2,3-bis(hydroxymethyl)cyclopenten-1-yl]ethoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OCC1=C(CCOC2OC(CO)C(O)C(O)C2O)CCC1CO |
| InChI | InChI=1S/C15H26O8/c16-5-9-2-1-8(10(9)6-17)3-4-22-15-14(21)13(20)12(19)11(7-18)23-15/h9,11-21H,1-7H2 |
| InChIKey | HLXIDWOXFIYQOX-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|