C9H16O4 — CID 14466830
2-[(1S,4R,5R)-4,5-bis(hydroxymethyl)-6-oxabicyclo[3.1.0]hexan-1-yl]ethanol (PubChem CID 14466830) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is 2-[(1S,4R,5R)-4,5-bis(hydroxymethyl)-6-oxabicyclo[3.1.0]hexan-1-yl]ethanol.
| Compound Name | 2-[(1S,4R,5R)-4,5-bis(hydroxymethyl)-6-oxabicyclo[3.1.0]hexan-1-yl]ethanol |
|---|---|
| PubChem CID | 14466830 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 2-[(1S,4R,5R)-4,5-bis(hydroxymethyl)-6-oxabicyclo[3.1.0]hexan-1-yl]ethanol |
| SMILES | OCC[C@@]12CC[C@H](CO)[C@]1(CO)O2 |
| InChI | InChI=1S/C9H16O4/c10-4-3-8-2-1-7(5-11)9(8,6-12)13-8/h7,10-12H,1-6H2/t7-,8+,9+/m1/s1 |
| InChIKey | KKVIERCIKBQLQG-VGMNWLOBSA-N |
| XLogP | -0.73 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|