About methane;4-methylsulfanylcyclohexa-1,3-dien-1-amine
methane;4-methylsulfanylcyclohexa-1,3-dien-1-amine (PubChem CID 144669288) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is methane;4-methylsulfanylcyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | methane;4-methylsulfanylcyclohexa-1,3-dien-1-amine |
| PubChem CID | 144669288 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | methane;4-methylsulfanylcyclohexa-1,3-dien-1-amine |
| SMILES | C.CSC1=CC=C(N)CC1 |
| InChI | InChI=1S/C7H11NS.CH4/c1-9-7-4-2-6(8)3-5-7;/h2,4H,3,5,8H2,1H3;1H4 |
| InChIKey | IMRFXWILMNGZIG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;4-methylsulfanylcyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;4-methylsulfanylcyclohexa-1,3-dien-1-amine?
The IUPAC name of methane;4-methylsulfanylcyclohexa-1,3-dien-1-amine (CID 144669288) is methane;4-methylsulfanylcyclohexa-1,3-dien-1-amine.
What is the SMILES notation for methane;4-methylsulfanylcyclohexa-1,3-dien-1-amine?
The canonical SMILES for methane;4-methylsulfanylcyclohexa-1,3-dien-1-amine is C.CSC1=CC=C(N)CC1.
What is the InChIKey of methane;4-methylsulfanylcyclohexa-1,3-dien-1-amine?
The InChIKey is IMRFXWILMNGZIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NS.CH4/c1-9-7-4-2-6(8)3-5-7;/h2,4H,3,5,8H2,1H3;1H4.
What are the key properties of methane;4-methylsulfanylcyclohexa-1,3-dien-1-amine?
methane;4-methylsulfanylcyclohexa-1,3-dien-1-amine has a molecular weight of 157.28 g/mol, XLogP of 2.51, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;4-methylsulfanylcyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 144669288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).