C22H35N3O — CID 144669349
2-(2-ethylhexoxy)-5-methylbenzene-1,4-diamine;4-methylaniline (PubChem CID 144669349) has the molecular formula C22H35N3O and a molecular weight of 357.54 g/mol. Its IUPAC name is 2-(2-ethylhexoxy)-5-methylbenzene-1,4-diamine;4-methylaniline.
| Compound Name | 2-(2-ethylhexoxy)-5-methylbenzene-1,4-diamine;4-methylaniline |
|---|---|
| PubChem CID | 144669349 |
| Molecular Formula | C22H35N3O |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.28 |
| IUPAC Name | 2-(2-ethylhexoxy)-5-methylbenzene-1,4-diamine;4-methylaniline |
| SMILES | CCCCC(CC)COc1cc(N)c(C)cc1N.Cc1ccc(N)cc1 |
| InChI | InChI=1S/C15H26N2O.C7H9N/c1-4-6-7-12(5-2)10-18-15-9-13(16)11(3)8-14(15)17;1-6-2-4-7(8)5-3-6/h8-9,12H,4-7,10,16-17H2,1-3H3;2-5H,8H2,1H3 |
| InChIKey | RFSMXKHKJMXJPL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|