About tert-butyl 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]piperidine-1-carboxylate;ethane
tert-butyl 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]piperidine-1-carboxylate;ethane (PubChem CID 144669791) has the molecular formula C21H35F2N3O2
and a molecular weight of 399.53 g/mol. Its IUPAC name is tert-butyl 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]piperidine-1-carboxylate;ethane.
Molecular Properties
| Compound Name | tert-butyl 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]piperidine-1-carboxylate;ethane |
| PubChem CID | 144669791 |
| Molecular Formula | C21H35F2N3O2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | tert-butyl 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]piperidine-1-carboxylate;ethane |
| SMILES | CC.Cc1cc(C2CCN(C(=O)OC(C)(C)C)CC2)n(C2CCC(F)(F)C2)n1 |
| InChI | InChI=1S/C19H29F2N3O2.C2H6/c1-13-11-16(24(22-13)15-5-8-19(20,21)12-15)14-6-9-23(10-7-14)17(25)26-18(2,3)4;1-2/h11,14-15H,5-10,12H2,1-4H3;1-2H3 |
| InChIKey | CMAHZLUXENXOLJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]piperidine-1-carboxylate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]piperidine-1-carboxylate;ethane?
The IUPAC name of tert-butyl 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]piperidine-1-carboxylate;ethane (CID 144669791) is tert-butyl 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]piperidine-1-carboxylate;ethane.
What is the SMILES notation for tert-butyl 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]piperidine-1-carboxylate;ethane?
The canonical SMILES for tert-butyl 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]piperidine-1-carboxylate;ethane is CC.Cc1cc(C2CCN(C(=O)OC(C)(C)C)CC2)n(C2CCC(F)(F)C2)n1.
What is the InChIKey of tert-butyl 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]piperidine-1-carboxylate;ethane?
The InChIKey is CMAHZLUXENXOLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29F2N3O2.C2H6/c1-13-11-16(24(22-13)15-5-8-19(20,21)12-15)14-6-9-23(10-7-14)17(25)26-18(2,3)4;1-2/h11,14-15H,5-10,12H2,1-4H3;1-2H3.
What are the key properties of tert-butyl 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]piperidine-1-carboxylate;ethane?
tert-butyl 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]piperidine-1-carboxylate;ethane has a molecular weight of 399.53 g/mol, XLogP of 5.69, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]piperidine-1-carboxylate;ethane is sourced from PubChem (CID 144669791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).