About 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]-1-(oxetan-3-yl)piperidine;ethane
4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]-1-(oxetan-3-yl)piperidine;ethane (PubChem CID 144669810) has the molecular formula C19H31F2N3O
and a molecular weight of 355.47 g/mol. Its IUPAC name is 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]-1-(oxetan-3-yl)piperidine;ethane.
Molecular Properties
| Compound Name | 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]-1-(oxetan-3-yl)piperidine;ethane |
| PubChem CID | 144669810 |
| Molecular Formula | C19H31F2N3O |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]-1-(oxetan-3-yl)piperidine;ethane |
| SMILES | CC.Cc1cc(C2CCN(C3COC3)CC2)n(C2CCC(F)(F)C2)n1 |
| InChI | InChI=1S/C17H25F2N3O.C2H6/c1-12-8-16(22(20-12)14-2-5-17(18,19)9-14)13-3-6-21(7-4-13)15-10-23-11-15;1-2/h8,13-15H,2-7,9-11H2,1H3;1-2H3 |
| InChIKey | GKXMYEGWVHMXOF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]-1-(oxetan-3-yl)piperidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]-1-(oxetan-3-yl)piperidine;ethane?
The IUPAC name of 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]-1-(oxetan-3-yl)piperidine;ethane (CID 144669810) is 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]-1-(oxetan-3-yl)piperidine;ethane.
What is the SMILES notation for 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]-1-(oxetan-3-yl)piperidine;ethane?
The canonical SMILES for 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]-1-(oxetan-3-yl)piperidine;ethane is CC.Cc1cc(C2CCN(C3COC3)CC2)n(C2CCC(F)(F)C2)n1.
What is the InChIKey of 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]-1-(oxetan-3-yl)piperidine;ethane?
The InChIKey is GKXMYEGWVHMXOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25F2N3O.C2H6/c1-12-8-16(22(20-12)14-2-5-17(18,19)9-14)13-3-6-21(7-4-13)15-10-23-11-15;1-2/h8,13-15H,2-7,9-11H2,1H3;1-2H3.
What are the key properties of 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]-1-(oxetan-3-yl)piperidine;ethane?
4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]-1-(oxetan-3-yl)piperidine;ethane has a molecular weight of 355.47 g/mol, XLogP of 4.16, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,3-difluorocyclopentyl)-5-methylpyrazol-3-yl]-1-(oxetan-3-yl)piperidine;ethane is sourced from PubChem (CID 144669810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).