About ethyl 2-[[(1R,4E)-4-(dimethylaminomethylidene)-3-oxocyclohexyl]methyl]-3-(propylamino)propanoate
ethyl 2-[[(1R,4E)-4-(dimethylaminomethylidene)-3-oxocyclohexyl]methyl]-3-(propylamino)propanoate (PubChem CID 144670557) has the molecular formula C18H32N2O3
and a molecular weight of 324.47 g/mol. Its IUPAC name is ethyl 2-[[(1R,4E)-4-(dimethylaminomethylidene)-3-oxocyclohexyl]methyl]-3-(propylamino)propanoate.
Molecular Properties
| Compound Name | ethyl 2-[[(1R,4E)-4-(dimethylaminomethylidene)-3-oxocyclohexyl]methyl]-3-(propylamino)propanoate |
| PubChem CID | 144670557 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | ethyl 2-[[(1R,4E)-4-(dimethylaminomethylidene)-3-oxocyclohexyl]methyl]-3-(propylamino)propanoate |
| SMILES | CCCNCC(C[C@H]1CC/C(=C\N(C)C)C(=O)C1)C(=O)OCC |
| InChI | InChI=1S/C18H32N2O3/c1-5-9-19-12-16(18(22)23-6-2)10-14-7-8-15(13-20(3)4)17(21)11-14/h13-14,16,19H,5-12H2,1-4H3/b15-13+/t14-,16?/m1/s1 |
| InChIKey | IYWADOKQUDMXMQ-ROZFDCISSA-N |
| XLogP | 2.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[(1R,4E)-4-(dimethylaminomethylidene)-3-oxocyclohexyl]methyl]-3-(propylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[(1R,4E)-4-(dimethylaminomethylidene)-3-oxocyclohexyl]methyl]-3-(propylamino)propanoate?
The IUPAC name of ethyl 2-[[(1R,4E)-4-(dimethylaminomethylidene)-3-oxocyclohexyl]methyl]-3-(propylamino)propanoate (CID 144670557) is ethyl 2-[[(1R,4E)-4-(dimethylaminomethylidene)-3-oxocyclohexyl]methyl]-3-(propylamino)propanoate.
What is the SMILES notation for ethyl 2-[[(1R,4E)-4-(dimethylaminomethylidene)-3-oxocyclohexyl]methyl]-3-(propylamino)propanoate?
The canonical SMILES for ethyl 2-[[(1R,4E)-4-(dimethylaminomethylidene)-3-oxocyclohexyl]methyl]-3-(propylamino)propanoate is CCCNCC(C[C@H]1CC/C(=C\N(C)C)C(=O)C1)C(=O)OCC.
What is the InChIKey of ethyl 2-[[(1R,4E)-4-(dimethylaminomethylidene)-3-oxocyclohexyl]methyl]-3-(propylamino)propanoate?
The InChIKey is IYWADOKQUDMXMQ-ROZFDCISSA-N. The full InChI is InChI=1S/C18H32N2O3/c1-5-9-19-12-16(18(22)23-6-2)10-14-7-8-15(13-20(3)4)17(21)11-14/h13-14,16,19H,5-12H2,1-4H3/b15-13+/t14-,16?/m1/s1.
What are the key properties of ethyl 2-[[(1R,4E)-4-(dimethylaminomethylidene)-3-oxocyclohexyl]methyl]-3-(propylamino)propanoate?
ethyl 2-[[(1R,4E)-4-(dimethylaminomethylidene)-3-oxocyclohexyl]methyl]-3-(propylamino)propanoate has a molecular weight of 324.47 g/mol, XLogP of 2.37, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[(1R,4E)-4-(dimethylaminomethylidene)-3-oxocyclohexyl]methyl]-3-(propylamino)propanoate is sourced from PubChem (CID 144670557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).