About 4,5-dimethyl-1,2-oxazol-3-amine;ethane
4,5-dimethyl-1,2-oxazol-3-amine;ethane (PubChem CID 144672034) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 4,5-dimethyl-1,2-oxazol-3-amine;ethane.
Molecular Properties
| Compound Name | 4,5-dimethyl-1,2-oxazol-3-amine;ethane |
| PubChem CID | 144672034 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 4,5-dimethyl-1,2-oxazol-3-amine;ethane |
| SMILES | CC.Cc1onc(N)c1C |
| InChI | InChI=1S/C5H8N2O.C2H6/c1-3-4(2)8-7-5(3)6;1-2/h1-2H3,(H2,6,7);1-2H3 |
| InChIKey | OOOHEJOSIJAXJO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dimethyl-1,2-oxazol-3-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-1,2-oxazol-3-amine;ethane?
The IUPAC name of 4,5-dimethyl-1,2-oxazol-3-amine;ethane (CID 144672034) is 4,5-dimethyl-1,2-oxazol-3-amine;ethane.
What is the SMILES notation for 4,5-dimethyl-1,2-oxazol-3-amine;ethane?
The canonical SMILES for 4,5-dimethyl-1,2-oxazol-3-amine;ethane is CC.Cc1onc(N)c1C.
What is the InChIKey of 4,5-dimethyl-1,2-oxazol-3-amine;ethane?
The InChIKey is OOOHEJOSIJAXJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O.C2H6/c1-3-4(2)8-7-5(3)6;1-2/h1-2H3,(H2,6,7);1-2H3.
What are the key properties of 4,5-dimethyl-1,2-oxazol-3-amine;ethane?
4,5-dimethyl-1,2-oxazol-3-amine;ethane has a molecular weight of 142.20 g/mol, XLogP of 1.90, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-1,2-oxazol-3-amine;ethane is sourced from PubChem (CID 144672034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).