About ethane;6-methyl-2,3,4,5-tetrahydro-1H-indene
ethane;6-methyl-2,3,4,5-tetrahydro-1H-indene (PubChem CID 144672111) has the molecular formula C12H20
and a molecular weight of 164.29 g/mol. Its IUPAC name is ethane;6-methyl-2,3,4,5-tetrahydro-1H-indene.
Molecular Properties
| Compound Name | ethane;6-methyl-2,3,4,5-tetrahydro-1H-indene |
| PubChem CID | 144672111 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | ethane;6-methyl-2,3,4,5-tetrahydro-1H-indene |
| SMILES | CC.CC1=CC2=C(CCC2)CC1 |
| InChI | InChI=1S/C10H14.C2H6/c1-8-5-6-9-3-2-4-10(9)7-8;1-2/h7H,2-6H2,1H3;1-2H3 |
| InChIKey | OWFNVDWLEGNVRA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;6-methyl-2,3,4,5-tetrahydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-methyl-2,3,4,5-tetrahydro-1H-indene?
The IUPAC name of ethane;6-methyl-2,3,4,5-tetrahydro-1H-indene (CID 144672111) is ethane;6-methyl-2,3,4,5-tetrahydro-1H-indene.
What is the SMILES notation for ethane;6-methyl-2,3,4,5-tetrahydro-1H-indene?
The canonical SMILES for ethane;6-methyl-2,3,4,5-tetrahydro-1H-indene is CC.CC1=CC2=C(CCC2)CC1.
What is the InChIKey of ethane;6-methyl-2,3,4,5-tetrahydro-1H-indene?
The InChIKey is OWFNVDWLEGNVRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C2H6/c1-8-5-6-9-3-2-4-10(9)7-8;1-2/h7H,2-6H2,1H3;1-2H3.
What are the key properties of ethane;6-methyl-2,3,4,5-tetrahydro-1H-indene?
ethane;6-methyl-2,3,4,5-tetrahydro-1H-indene has a molecular weight of 164.29 g/mol, XLogP of 4.23, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-methyl-2,3,4,5-tetrahydro-1H-indene is sourced from PubChem (CID 144672111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).