About 2-(2-bromothieno[2,3-f][1]benzothiol-6-yl)acetonitrile;ethane
2-(2-bromothieno[2,3-f][1]benzothiol-6-yl)acetonitrile;ethane (PubChem CID 144672130) has the molecular formula C14H12BrNS2
and a molecular weight of 338.30 g/mol. Its IUPAC name is 2-(2-bromothieno[2,3-f][1]benzothiol-6-yl)acetonitrile;ethane.
Molecular Properties
| Compound Name | 2-(2-bromothieno[2,3-f][1]benzothiol-6-yl)acetonitrile;ethane |
| PubChem CID | 144672130 |
| Molecular Formula | C14H12BrNS2 |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 336.96 |
| IUPAC Name | 2-(2-bromothieno[2,3-f][1]benzothiol-6-yl)acetonitrile;ethane |
| SMILES | CC.N#CCc1cc2cc3sc(Br)cc3cc2s1 |
| InChI | InChI=1S/C12H6BrNS2.C2H6/c13-12-6-8-5-10-7(4-11(8)16-12)3-9(15-10)1-2-14;1-2/h3-6H,1H2;1-2H3 |
| InChIKey | QSPDGDPRZPXRFZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-bromothieno[2,3-f][1]benzothiol-6-yl)acetonitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromothieno[2,3-f][1]benzothiol-6-yl)acetonitrile;ethane?
The IUPAC name of 2-(2-bromothieno[2,3-f][1]benzothiol-6-yl)acetonitrile;ethane (CID 144672130) is 2-(2-bromothieno[2,3-f][1]benzothiol-6-yl)acetonitrile;ethane.
What is the SMILES notation for 2-(2-bromothieno[2,3-f][1]benzothiol-6-yl)acetonitrile;ethane?
The canonical SMILES for 2-(2-bromothieno[2,3-f][1]benzothiol-6-yl)acetonitrile;ethane is CC.N#CCc1cc2cc3sc(Br)cc3cc2s1.
What is the InChIKey of 2-(2-bromothieno[2,3-f][1]benzothiol-6-yl)acetonitrile;ethane?
The InChIKey is QSPDGDPRZPXRFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6BrNS2.C2H6/c13-12-6-8-5-10-7(4-11(8)16-12)3-9(15-10)1-2-14;1-2/h3-6H,1H2;1-2H3.
What are the key properties of 2-(2-bromothieno[2,3-f][1]benzothiol-6-yl)acetonitrile;ethane?
2-(2-bromothieno[2,3-f][1]benzothiol-6-yl)acetonitrile;ethane has a molecular weight of 338.30 g/mol, XLogP of 5.97, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromothieno[2,3-f][1]benzothiol-6-yl)acetonitrile;ethane is sourced from PubChem (CID 144672130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).