About [1-[2-[4-(1-oxo-2H-isoquinolin-4-yl)phenyl]acetyl]-2,3-dihydroindol-6-yl] hypofluorite
[1-[2-[4-(1-oxo-2H-isoquinolin-4-yl)phenyl]acetyl]-2,3-dihydroindol-6-yl] hypofluorite (PubChem CID 144672589) has the molecular formula C25H19FN2O3
and a molecular weight of 414.44 g/mol. Its IUPAC name is [1-[2-[4-(1-oxo-2H-isoquinolin-4-yl)phenyl]acetyl]-2,3-dihydroindol-6-yl] hypofluorite.
Molecular Properties
| Compound Name | [1-[2-[4-(1-oxo-2H-isoquinolin-4-yl)phenyl]acetyl]-2,3-dihydroindol-6-yl] hypofluorite |
| PubChem CID | 144672589 |
| Molecular Formula | C25H19FN2O3 |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | [1-[2-[4-(1-oxo-2H-isoquinolin-4-yl)phenyl]acetyl]-2,3-dihydroindol-6-yl] hypofluorite |
| SMILES | O=C(Cc1ccc(-c2c[nH]c(=O)c3ccccc23)cc1)N1CCc2ccc(OF)cc21 |
| InChI | InChI=1S/C25H19FN2O3/c26-31-19-10-9-18-11-12-28(23(18)14-19)24(29)13-16-5-7-17(8-6-16)22-15-27-25(30)21-4-2-1-3-20(21)22/h1-10,14-15H,11-13H2,(H,27,30) |
| InChIKey | GCNADVGFOMEQHB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[2-[4-(1-oxo-2H-isoquinolin-4-yl)phenyl]acetyl]-2,3-dihydroindol-6-yl] hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-[4-(1-oxo-2H-isoquinolin-4-yl)phenyl]acetyl]-2,3-dihydroindol-6-yl] hypofluorite?
The IUPAC name of [1-[2-[4-(1-oxo-2H-isoquinolin-4-yl)phenyl]acetyl]-2,3-dihydroindol-6-yl] hypofluorite (CID 144672589) is [1-[2-[4-(1-oxo-2H-isoquinolin-4-yl)phenyl]acetyl]-2,3-dihydroindol-6-yl] hypofluorite.
What is the SMILES notation for [1-[2-[4-(1-oxo-2H-isoquinolin-4-yl)phenyl]acetyl]-2,3-dihydroindol-6-yl] hypofluorite?
The canonical SMILES for [1-[2-[4-(1-oxo-2H-isoquinolin-4-yl)phenyl]acetyl]-2,3-dihydroindol-6-yl] hypofluorite is O=C(Cc1ccc(-c2c[nH]c(=O)c3ccccc23)cc1)N1CCc2ccc(OF)cc21.
What is the InChIKey of [1-[2-[4-(1-oxo-2H-isoquinolin-4-yl)phenyl]acetyl]-2,3-dihydroindol-6-yl] hypofluorite?
The InChIKey is GCNADVGFOMEQHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19FN2O3/c26-31-19-10-9-18-11-12-28(23(18)14-19)24(29)13-16-5-7-17(8-6-16)22-15-27-25(30)21-4-2-1-3-20(21)22/h1-10,14-15H,11-13H2,(H,27,30).
What are the key properties of [1-[2-[4-(1-oxo-2H-isoquinolin-4-yl)phenyl]acetyl]-2,3-dihydroindol-6-yl] hypofluorite?
[1-[2-[4-(1-oxo-2H-isoquinolin-4-yl)phenyl]acetyl]-2,3-dihydroindol-6-yl] hypofluorite has a molecular weight of 414.44 g/mol, XLogP of 4.59, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-[4-(1-oxo-2H-isoquinolin-4-yl)phenyl]acetyl]-2,3-dihydroindol-6-yl] hypofluorite is sourced from PubChem (CID 144672589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).