About (Z)-1-[amino-[(Z)-prop-1-enyl]amino]-N-ethylprop-1-en-1-amine;propane
(Z)-1-[amino-[(Z)-prop-1-enyl]amino]-N-ethylprop-1-en-1-amine;propane (PubChem CID 144672698) has the molecular formula C11H25N3
and a molecular weight of 199.34 g/mol. Its IUPAC name is (Z)-1-[amino-[(Z)-prop-1-enyl]amino]-N-ethylprop-1-en-1-amine;propane.
Molecular Properties
| Compound Name | (Z)-1-[amino-[(Z)-prop-1-enyl]amino]-N-ethylprop-1-en-1-amine;propane |
| PubChem CID | 144672698 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | (Z)-1-[amino-[(Z)-prop-1-enyl]amino]-N-ethylprop-1-en-1-amine;propane |
| SMILES | C/C=C\N(N)/C(=C\C)NCC.CCC |
| InChI | InChI=1S/C8H17N3.C3H8/c1-4-7-11(9)8(5-2)10-6-3;1-3-2/h4-5,7,10H,6,9H2,1-3H3;3H2,1-2H3/b7-4-,8-5-; |
| InChIKey | DNKLATSELLFYGJ-DNNMRGOVSA-N |
| XLogP | 2.58 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-[amino-[(Z)-prop-1-enyl]amino]-N-ethylprop-1-en-1-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-[amino-[(Z)-prop-1-enyl]amino]-N-ethylprop-1-en-1-amine;propane?
The IUPAC name of (Z)-1-[amino-[(Z)-prop-1-enyl]amino]-N-ethylprop-1-en-1-amine;propane (CID 144672698) is (Z)-1-[amino-[(Z)-prop-1-enyl]amino]-N-ethylprop-1-en-1-amine;propane.
What is the SMILES notation for (Z)-1-[amino-[(Z)-prop-1-enyl]amino]-N-ethylprop-1-en-1-amine;propane?
The canonical SMILES for (Z)-1-[amino-[(Z)-prop-1-enyl]amino]-N-ethylprop-1-en-1-amine;propane is C/C=C\N(N)/C(=C\C)NCC.CCC.
What is the InChIKey of (Z)-1-[amino-[(Z)-prop-1-enyl]amino]-N-ethylprop-1-en-1-amine;propane?
The InChIKey is DNKLATSELLFYGJ-DNNMRGOVSA-N. The full InChI is InChI=1S/C8H17N3.C3H8/c1-4-7-11(9)8(5-2)10-6-3;1-3-2/h4-5,7,10H,6,9H2,1-3H3;3H2,1-2H3/b7-4-,8-5-;.
What are the key properties of (Z)-1-[amino-[(Z)-prop-1-enyl]amino]-N-ethylprop-1-en-1-amine;propane?
(Z)-1-[amino-[(Z)-prop-1-enyl]amino]-N-ethylprop-1-en-1-amine;propane has a molecular weight of 199.34 g/mol, XLogP of 2.58, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-[amino-[(Z)-prop-1-enyl]amino]-N-ethylprop-1-en-1-amine;propane is sourced from PubChem (CID 144672698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).