C27H24FN5O7 — CID 144673389
(4'R)-13'-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-17'-fluoro-4'-methylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione (PubChem CID 144673389) has the molecular formula C27H24FN5O7 and a molecular weight of 549.52 g/mol. Its IUPAC name is (4'R)-13'-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-17'-fluoro-4'-methylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione.
| Compound Name | (4'R)-13'-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-17'-fluoro-4'-methylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
|---|---|
| PubChem CID | 144673389 |
| Molecular Formula | C27H24FN5O7 |
| Molecular Weight | 549.52 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | (4'R)-13'-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-17'-fluoro-4'-methylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
| SMILES | C[C@@H]1CN2c3c(cc4c(N5C(=O)OCC5Cc5ccccc5)noc4c3F)CC3(C(=O)NC(=O)NC3=O)C2CO1 |
| InChI | InChI=1S/C27H24FN5O7/c1-13-10-32-18(12-38-13)27(23(34)29-25(36)30-24(27)35)9-15-8-17-21(19(28)20(15)32)40-31-22(17)33-16(11-39-26(33)37)7-14-5-3-2-4-6-14/h2-6,8,13,16,18H,7,9-12H2,1H3,(H2,29,30,34,35,36)/t13-,16?,18?/m1/s1 |
| InChIKey | RBUKAKZAJHXHLC-IMUUDWKMSA-N |
| XLogP | 2.04 |
| TPSA | 143.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.52 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|