C24H26N2O4 — CID 144673461
ethyl 2-(2-methoxyphenyl)-5-(4-methylbenzoyl)-1-propan-2-ylimidazole-4-carboxylate (PubChem CID 144673461) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is ethyl 2-(2-methoxyphenyl)-5-(4-methylbenzoyl)-1-propan-2-ylimidazole-4-carboxylate.
| Compound Name | ethyl 2-(2-methoxyphenyl)-5-(4-methylbenzoyl)-1-propan-2-ylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 144673461 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | ethyl 2-(2-methoxyphenyl)-5-(4-methylbenzoyl)-1-propan-2-ylimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccccc2OC)n(C(C)C)c1C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H26N2O4/c1-6-30-24(28)20-21(22(27)17-13-11-16(4)12-14-17)26(15(2)3)23(25-20)18-9-7-8-10-19(18)29-5/h7-15H,6H2,1-5H3 |
| InChIKey | CNXXWVBRRPTRSR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |