C58H38N6 — CID 144673812
5-[6-carbazol-9-yl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]-10H-cyclohepta[b]indole (PubChem CID 144673812) has the molecular formula C58H38N6 and a molecular weight of 818.98 g/mol. Its IUPAC name is 5-[6-carbazol-9-yl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]-10H-cyclohepta[b]indole.
| Compound Name | 5-[6-carbazol-9-yl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]-10H-cyclohepta[b]indole |
|---|---|
| PubChem CID | 144673812 |
| Molecular Formula | C58H38N6 |
| Molecular Weight | 818.98 g/mol |
| Exact Mass | 818.32 |
| IUPAC Name | 5-[6-carbazol-9-yl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]-10H-cyclohepta[b]indole |
| SMILES | C1=CCc2c(n(-c3ccc4c(c3)c3cc(-n5c6ccccc6c6ccccc65)ccc3n4-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)c3ccccc23)C=C1 |
| InChI | InChI=1S/C58H38N6/c1-4-16-38(17-5-1)56-59-57(39-18-6-2-7-19-39)61-58(60-56)40-28-30-41(31-29-40)62-54-34-32-42(63-50-24-9-3-8-20-44(50)45-21-10-13-25-51(45)63)36-48(54)49-37-43(33-35-55(49)62)64-52-26-14-11-22-46(52)47-23-12-15-27-53(47)64/h1-19,21-37H,20H2 |
| InChIKey | UOZTYDUWUBGPCM-UHFFFAOYSA-N |
| XLogP | 14.14 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.98 |
| LogP ≤ 5 | 14.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |