C25H23B4N3O5 — CID 144674148
CID 144674148 (PubChem CID 144674148) has the molecular formula C25H23B4N3O5 and a molecular weight of 488.72 g/mol.
| Compound Name | CID 144674148 |
|---|---|
| PubChem CID | 144674148 |
| Molecular Formula | C25H23B4N3O5 |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | — |
| SMILES | [B]c1c(C([B])Oc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)ccc(C([B])N2CCOCC2)c1[B] |
| InChI | InChI=1S/C25H23B4N3O5/c26-20-14(22(28)31-8-10-36-11-9-31)4-5-15(21(20)27)23(29)37-18-3-1-2-13-16(18)12-32(25(13)35)17-6-7-19(33)30-24(17)34/h1-5,17,22-23H,6-12H2,(H,30,33,34) |
| InChIKey | SLVWIHYXJGPUDS-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|