C9H17NO4 — CID 144675076
4-acetylmorpholine-2-carboxylic acid;ethane (PubChem CID 144675076) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is 4-acetylmorpholine-2-carboxylic acid;ethane.
| Compound Name | 4-acetylmorpholine-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 144675076 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 4-acetylmorpholine-2-carboxylic acid;ethane |
| SMILES | CC.CC(=O)N1CCOC(C(=O)O)C1 |
| InChI | InChI=1S/C7H11NO4.C2H6/c1-5(9)8-2-3-12-6(4-8)7(10)11;1-2/h6H,2-4H2,1H3,(H,10,11);1-2H3 |
| InChIKey | JXOWRWDVAKJITI-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |