C26H26F3N5O4S — CID 144675112
methylhydrazine;1,1,1-trifluoro-N-[3-[4-[4-(4-formyl-1,6-naphthyridin-2-yl)phenyl]phenoxy]propyl]methanesulfonamide (PubChem CID 144675112) has the molecular formula C26H26F3N5O4S and a molecular weight of 561.59 g/mol. Its IUPAC name is methylhydrazine;1,1,1-trifluoro-N-[3-[4-[4-(4-formyl-1,6-naphthyridin-2-yl)phenyl]phenoxy]propyl]methanesulfonamide.
| Compound Name | methylhydrazine;1,1,1-trifluoro-N-[3-[4-[4-(4-formyl-1,6-naphthyridin-2-yl)phenyl]phenoxy]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 144675112 |
| Molecular Formula | C26H26F3N5O4S |
| Molecular Weight | 561.59 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | methylhydrazine;1,1,1-trifluoro-N-[3-[4-[4-(4-formyl-1,6-naphthyridin-2-yl)phenyl]phenoxy]propyl]methanesulfonamide |
| SMILES | CNN.O=Cc1cc(-c2ccc(-c3ccc(OCCCNS(=O)(=O)C(F)(F)F)cc3)cc2)nc2ccncc12 |
| InChI | InChI=1S/C25H20F3N3O4S.CH6N2/c26-25(27,28)36(33,34)30-11-1-13-35-21-8-6-18(7-9-21)17-2-4-19(5-3-17)24-14-20(16-32)22-15-29-12-10-23(22)31-24;1-3-2/h2-10,12,14-16,30H,1,11,13H2;3H,2H2,1H3 |
| InChIKey | FFRYTALPYDHMIY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|