C11H12FN — CID 144676071
(5Z)-5-(fluoromethylidene)-4-[(3E)-hexa-1,3,5-trien-3-yl]-1,2-dihydropyrrole (PubChem CID 144676071) has the molecular formula C11H12FN and a molecular weight of 177.22 g/mol. Its IUPAC name is (5Z)-5-(fluoromethylidene)-4-[(3E)-hexa-1,3,5-trien-3-yl]-1,2-dihydropyrrole.
| Compound Name | (5Z)-5-(fluoromethylidene)-4-[(3E)-hexa-1,3,5-trien-3-yl]-1,2-dihydropyrrole |
|---|---|
| PubChem CID | 144676071 |
| Molecular Formula | C11H12FN |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | (5Z)-5-(fluoromethylidene)-4-[(3E)-hexa-1,3,5-trien-3-yl]-1,2-dihydropyrrole |
| SMILES | C=C/C=C(\C=C)C1=CCN/C1=C\F |
| InChI | InChI=1S/C11H12FN/c1-3-5-9(4-2)10-6-7-13-11(10)8-12/h3-6,8,13H,1-2,7H2/b9-5+,11-8- |
| InChIKey | NSMWWTPIPDHFNC-HUEHMTQISA-N |
| XLogP | 2.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|