C21H31NO3 — CID 144676975
(3E,5Z)-3-[3-[(2E,4Z)-3,6-dimethylhepta-2,4,6-trien-2-yl]oxyprop-1-en-2-yl]-2-methoxy-N-methylhepta-3,5-dienamide (PubChem CID 144676975) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is (3E,5Z)-3-[3-[(2E,4Z)-3,6-dimethylhepta-2,4,6-trien-2-yl]oxyprop-1-en-2-yl]-2-methoxy-N-methylhepta-3,5-dienamide.
| Compound Name | (3E,5Z)-3-[3-[(2E,4Z)-3,6-dimethylhepta-2,4,6-trien-2-yl]oxyprop-1-en-2-yl]-2-methoxy-N-methylhepta-3,5-dienamide |
|---|---|
| PubChem CID | 144676975 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | (3E,5Z)-3-[3-[(2E,4Z)-3,6-dimethylhepta-2,4,6-trien-2-yl]oxyprop-1-en-2-yl]-2-methoxy-N-methylhepta-3,5-dienamide |
| SMILES | C=C(C)/C=C\C(C)=C(/C)OCC(=C)/C(=C\C=C/C)C(OC)C(=O)NC |
| InChI | InChI=1S/C21H31NO3/c1-9-10-11-19(20(24-8)21(23)22-7)17(5)14-25-18(6)16(4)13-12-15(2)3/h9-13,20H,2,5,14H2,1,3-4,6-8H3,(H,22,23)/b10-9-,13-12-,18-16+,19-11+ |
| InChIKey | RSVYJECJUGCUOX-HLACOVPGSA-N |
| XLogP | 4.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|