C25H28O3S — CID 144677235
[4-(cyclohepta-1,4,6-trien-1-yl-hydroxy-phenyl-λ4-sulfanyl)phenyl] hexanoate (PubChem CID 144677235) has the molecular formula C25H28O3S and a molecular weight of 408.56 g/mol. Its IUPAC name is [4-(cyclohepta-1,4,6-trien-1-yl-hydroxy-phenyl-λ4-sulfanyl)phenyl] hexanoate.
| Compound Name | [4-(cyclohepta-1,4,6-trien-1-yl-hydroxy-phenyl-λ4-sulfanyl)phenyl] hexanoate |
|---|---|
| PubChem CID | 144677235 |
| Molecular Formula | C25H28O3S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [4-(cyclohepta-1,4,6-trien-1-yl-hydroxy-phenyl-λ4-sulfanyl)phenyl] hexanoate |
| SMILES | CCCCCC(=O)Oc1ccc(S(O)(C2=CCC=CC=C2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H28O3S/c1-2-3-7-16-25(26)28-21-17-19-24(20-18-21)29(27,23-14-10-6-11-15-23)22-12-8-4-5-9-13-22/h4-6,8,10-15,17-20,27H,2-3,7,9,16H2,1H3 |
| InChIKey | DHOUIXFTZLTPMO-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|