About butylastatine;(NE)-N-[1-(2-fluoro-5-nitrophenyl)ethylidene]thiohydroxylamine
butylastatine;(NE)-N-[1-(2-fluoro-5-nitrophenyl)ethylidene]thiohydroxylamine (PubChem CID 144677804) has the molecular formula C12H16AtFN2O2S
and a molecular weight of 481.34 g/mol. Its IUPAC name is butylastatine;(NE)-N-[1-(2-fluoro-5-nitrophenyl)ethylidene]thiohydroxylamine.
Molecular Properties
| Compound Name | butylastatine;(NE)-N-[1-(2-fluoro-5-nitrophenyl)ethylidene]thiohydroxylamine |
| PubChem CID | 144677804 |
| Molecular Formula | C12H16AtFN2O2S |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | butylastatine;(NE)-N-[1-(2-fluoro-5-nitrophenyl)ethylidene]thiohydroxylamine |
| SMILES | C/C(=N\S)c1cc([N+](=O)[O-])ccc1F.CCCC[At] |
| InChI | InChI=1S/C8H7FN2O2S.C4H9At/c1-5(10-14)7-4-6(11(12)13)2-3-8(7)9;1-2-3-4-5/h2-4,14H,1H3;2-4H2,1H3/b10-5+; |
| InChIKey | OSFQMIOBROFPCC-OAZHBLANSA-N |
| XLogP | 4.14 |
| TPSA | 55.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze butylastatine;(NE)-N-[1-(2-fluoro-5-nitrophenyl)ethylidene]thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylastatine;(NE)-N-[1-(2-fluoro-5-nitrophenyl)ethylidene]thiohydroxylamine?
The IUPAC name of butylastatine;(NE)-N-[1-(2-fluoro-5-nitrophenyl)ethylidene]thiohydroxylamine (CID 144677804) is butylastatine;(NE)-N-[1-(2-fluoro-5-nitrophenyl)ethylidene]thiohydroxylamine.
What is the SMILES notation for butylastatine;(NE)-N-[1-(2-fluoro-5-nitrophenyl)ethylidene]thiohydroxylamine?
The canonical SMILES for butylastatine;(NE)-N-[1-(2-fluoro-5-nitrophenyl)ethylidene]thiohydroxylamine is C/C(=N\S)c1cc([N+](=O)[O-])ccc1F.CCCC[At].
What is the InChIKey of butylastatine;(NE)-N-[1-(2-fluoro-5-nitrophenyl)ethylidene]thiohydroxylamine?
The InChIKey is OSFQMIOBROFPCC-OAZHBLANSA-N. The full InChI is InChI=1S/C8H7FN2O2S.C4H9At/c1-5(10-14)7-4-6(11(12)13)2-3-8(7)9;1-2-3-4-5/h2-4,14H,1H3;2-4H2,1H3/b10-5+;.
What are the key properties of butylastatine;(NE)-N-[1-(2-fluoro-5-nitrophenyl)ethylidene]thiohydroxylamine?
butylastatine;(NE)-N-[1-(2-fluoro-5-nitrophenyl)ethylidene]thiohydroxylamine has a molecular weight of 481.34 g/mol, XLogP of 4.14, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butylastatine;(NE)-N-[1-(2-fluoro-5-nitrophenyl)ethylidene]thiohydroxylamine is sourced from PubChem (CID 144677804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).