C18H19N5O5 — CID 144677926
[2-[3-(2-hydroxyethylamino)-3-oxopropoxy]-5-methylphenyl] 7H-purine-2-carboxylate (PubChem CID 144677926) has the molecular formula C18H19N5O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is [2-[3-(2-hydroxyethylamino)-3-oxopropoxy]-5-methylphenyl] 7H-purine-2-carboxylate.
| Compound Name | [2-[3-(2-hydroxyethylamino)-3-oxopropoxy]-5-methylphenyl] 7H-purine-2-carboxylate |
|---|---|
| PubChem CID | 144677926 |
| Molecular Formula | C18H19N5O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | [2-[3-(2-hydroxyethylamino)-3-oxopropoxy]-5-methylphenyl] 7H-purine-2-carboxylate |
| SMILES | Cc1ccc(OCCC(=O)NCCO)c(OC(=O)c2ncc3[nH]cnc3n2)c1 |
| InChI | InChI=1S/C18H19N5O5/c1-11-2-3-13(27-7-4-15(25)19-5-6-24)14(8-11)28-18(26)17-20-9-12-16(23-17)22-10-21-12/h2-3,8-10,24H,4-7H2,1H3,(H,19,25)(H,20,21,22,23) |
| InChIKey | BYMQEKYUGXUQQC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 139.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|