C29H49F3N8O2 — CID 144677951
5-[6-[[(1R)-1-cyclobutylethyl]amino]-7,9-dimethyl-8-[propyl(2,2,2-trifluoroethyl)amino]-8H-purin-2-yl]-3H-1,3,4-oxadiazol-2-one;ethane;methylcyclohexane (PubChem CID 144677951) has the molecular formula C29H49F3N8O2 and a molecular weight of 598.76 g/mol. Its IUPAC name is 5-[6-[[(1R)-1-cyclobutylethyl]amino]-7,9-dimethyl-8-[propyl(2,2,2-trifluoroethyl)amino]-8H-purin-2-yl]-3H-1,3,4-oxadiazol-2-one;ethane;methylcyclohexane.
| Compound Name | 5-[6-[[(1R)-1-cyclobutylethyl]amino]-7,9-dimethyl-8-[propyl(2,2,2-trifluoroethyl)amino]-8H-purin-2-yl]-3H-1,3,4-oxadiazol-2-one;ethane;methylcyclohexane |
|---|---|
| PubChem CID | 144677951 |
| Molecular Formula | C29H49F3N8O2 |
| Molecular Weight | 598.76 g/mol |
| Exact Mass | 598.39 |
| IUPAC Name | 5-[6-[[(1R)-1-cyclobutylethyl]amino]-7,9-dimethyl-8-[propyl(2,2,2-trifluoroethyl)amino]-8H-purin-2-yl]-3H-1,3,4-oxadiazol-2-one;ethane;methylcyclohexane |
| SMILES | CC.CC1CCCCC1.CCCN(CC(F)(F)F)C1N(C)c2nc(-c3n[nH]c(=O)o3)nc(N[C@H](C)C3CCC3)c2N1C |
| InChI | InChI=1S/C20H29F3N8O2.C7H14.C2H6/c1-5-9-31(10-20(21,22)23)19-29(3)13-14(24-11(2)12-7-6-8-12)25-15(26-16(13)30(19)4)17-27-28-18(32)33-17;1-7-5-3-2-4-6-7;1-2/h11-12,19H,5-10H2,1-4H3,(H,28,32)(H,24,25,26);7H,2-6H2,1H3;1-2H3/t11-,19?;;/m1../s1 |
| InChIKey | XTVOZAGGCWGUEE-YDYNMCNLSA-N |
| XLogP | 6.48 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.76 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |