C29H40ClN7O3 — CID 144678335
acetylene;(Z)-[amino-[4-(3-chlorophenyl)-5-(ethylamino)-6-(8-oxa-5-azaspiro[3.5]nonan-5-ylamino)pyrimidin-2-yl]methylidene]carbamic acid;cyclohexane (PubChem CID 144678335) has the molecular formula C29H40ClN7O3 and a molecular weight of 570.14 g/mol. Its IUPAC name is acetylene;(Z)-[amino-[4-(3-chlorophenyl)-5-(ethylamino)-6-(8-oxa-5-azaspiro[3.5]nonan-5-ylamino)pyrimidin-2-yl]methylidene]carbamic acid;cyclohexane.
| Compound Name | acetylene;(Z)-[amino-[4-(3-chlorophenyl)-5-(ethylamino)-6-(8-oxa-5-azaspiro[3.5]nonan-5-ylamino)pyrimidin-2-yl]methylidene]carbamic acid;cyclohexane |
|---|---|
| PubChem CID | 144678335 |
| Molecular Formula | C29H40ClN7O3 |
| Molecular Weight | 570.14 g/mol |
| Exact Mass | 569.29 |
| IUPAC Name | acetylene;(Z)-[amino-[4-(3-chlorophenyl)-5-(ethylamino)-6-(8-oxa-5-azaspiro[3.5]nonan-5-ylamino)pyrimidin-2-yl]methylidene]carbamic acid;cyclohexane |
| SMILES | C#C.C1CCCCC1.CCNc1c(NN2CCOCC23CCC3)nc(/C(N)=N/C(=O)O)nc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H26ClN7O3.C6H12.C2H2/c1-2-24-16-15(13-5-3-6-14(22)11-13)25-19(17(23)26-20(30)31)27-18(16)28-29-9-10-32-12-21(29)7-4-8-21;1-2-4-6-5-3-1;1-2/h3,5-6,11,24H,2,4,7-10,12H2,1H3,(H2,23,26)(H,30,31)(H,25,27,28);1-6H2;1-2H |
| InChIKey | LDGSBDBWNHZZCX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 137.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.14 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|