About N-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)formamide
N-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)formamide (PubChem CID 144679383) has the molecular formula C9H10BNO3
and a molecular weight of 191.00 g/mol. Its IUPAC name is N-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)formamide.
Molecular Properties
| Compound Name | N-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)formamide |
| PubChem CID | 144679383 |
| Molecular Formula | C9H10BNO3 |
| Molecular Weight | 191.00 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | N-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)formamide |
| SMILES | O=CNc1ccc2c(c1)B(O)OCC2 |
| InChI | InChI=1S/C9H10BNO3/c12-6-11-8-2-1-7-3-4-14-10(13)9(7)5-8/h1-2,5-6,13H,3-4H2,(H,11,12) |
| InChIKey | VVEIWBLVXISFRB-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.00 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)formamide?
The IUPAC name of N-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)formamide (CID 144679383) is N-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)formamide.
What is the SMILES notation for N-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)formamide?
The canonical SMILES for N-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)formamide is O=CNc1ccc2c(c1)B(O)OCC2.
What is the InChIKey of N-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)formamide?
The InChIKey is VVEIWBLVXISFRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BNO3/c12-6-11-8-2-1-7-3-4-14-10(13)9(7)5-8/h1-2,5-6,13H,3-4H2,(H,11,12).
What are the key properties of N-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)formamide?
N-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)formamide has a molecular weight of 191.00 g/mol, XLogP of -0.48, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)formamide is sourced from PubChem (CID 144679383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).