C14H23NO3 — CID 144679503
(4E,6Z)-3-[tert-butyl(hydroxy)amino]-2-methylnona-4,6,8-trienoic acid (PubChem CID 144679503) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is (4E,6Z)-3-[tert-butyl(hydroxy)amino]-2-methylnona-4,6,8-trienoic acid.
| Compound Name | (4E,6Z)-3-[tert-butyl(hydroxy)amino]-2-methylnona-4,6,8-trienoic acid |
|---|---|
| PubChem CID | 144679503 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | (4E,6Z)-3-[tert-butyl(hydroxy)amino]-2-methylnona-4,6,8-trienoic acid |
| SMILES | C=C/C=C\C=C\C(C(C)C(=O)O)N(O)C(C)(C)C |
| InChI | InChI=1S/C14H23NO3/c1-6-7-8-9-10-12(11(2)13(16)17)15(18)14(3,4)5/h6-12,18H,1H2,2-5H3,(H,16,17)/b8-7-,10-9+ |
| InChIKey | IOUFWPKHMTVFDB-UQGDGPGGSA-N |
| XLogP | 2.86 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|