About 5-bromo-N,2-dimethyl-6-(methylamino)-1-benzofuran-3-carboxamide;ethane
5-bromo-N,2-dimethyl-6-(methylamino)-1-benzofuran-3-carboxamide;ethane (PubChem CID 144679717) has the molecular formula C14H19BrN2O2
and a molecular weight of 327.22 g/mol. Its IUPAC name is 5-bromo-N,2-dimethyl-6-(methylamino)-1-benzofuran-3-carboxamide;ethane.
Molecular Properties
| Compound Name | 5-bromo-N,2-dimethyl-6-(methylamino)-1-benzofuran-3-carboxamide;ethane |
| PubChem CID | 144679717 |
| Molecular Formula | C14H19BrN2O2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 5-bromo-N,2-dimethyl-6-(methylamino)-1-benzofuran-3-carboxamide;ethane |
| SMILES | CC.CNC(=O)c1c(C)oc2cc(NC)c(Br)cc12 |
| InChI | InChI=1S/C12H13BrN2O2.C2H6/c1-6-11(12(16)15-3)7-4-8(13)9(14-2)5-10(7)17-6;1-2/h4-5,14H,1-3H3,(H,15,16);1-2H3 |
| InChIKey | BETLKGSJPGMRFE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-N,2-dimethyl-6-(methylamino)-1-benzofuran-3-carboxamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N,2-dimethyl-6-(methylamino)-1-benzofuran-3-carboxamide;ethane?
The IUPAC name of 5-bromo-N,2-dimethyl-6-(methylamino)-1-benzofuran-3-carboxamide;ethane (CID 144679717) is 5-bromo-N,2-dimethyl-6-(methylamino)-1-benzofuran-3-carboxamide;ethane.
What is the SMILES notation for 5-bromo-N,2-dimethyl-6-(methylamino)-1-benzofuran-3-carboxamide;ethane?
The canonical SMILES for 5-bromo-N,2-dimethyl-6-(methylamino)-1-benzofuran-3-carboxamide;ethane is CC.CNC(=O)c1c(C)oc2cc(NC)c(Br)cc12.
What is the InChIKey of 5-bromo-N,2-dimethyl-6-(methylamino)-1-benzofuran-3-carboxamide;ethane?
The InChIKey is BETLKGSJPGMRFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrN2O2.C2H6/c1-6-11(12(16)15-3)7-4-8(13)9(14-2)5-10(7)17-6;1-2/h4-5,14H,1-3H3,(H,15,16);1-2H3.
What are the key properties of 5-bromo-N,2-dimethyl-6-(methylamino)-1-benzofuran-3-carboxamide;ethane?
5-bromo-N,2-dimethyl-6-(methylamino)-1-benzofuran-3-carboxamide;ethane has a molecular weight of 327.22 g/mol, XLogP of 3.93, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N,2-dimethyl-6-(methylamino)-1-benzofuran-3-carboxamide;ethane is sourced from PubChem (CID 144679717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).