C14H24B2O4 — CID 144679836
(2S)-1,6,7,7,12,12-hexamethyl-8,11,13,14-tetraoxa-9,10-diboratetracyclo[8.2.1.16,9.02,4]tetradecane (PubChem CID 144679836) has the molecular formula C14H24B2O4 and a molecular weight of 277.97 g/mol. Its IUPAC name is (2S)-1,6,7,7,12,12-hexamethyl-8,11,13,14-tetraoxa-9,10-diboratetracyclo[8.2.1.16,9.02,4]tetradecane.
| Compound Name | (2S)-1,6,7,7,12,12-hexamethyl-8,11,13,14-tetraoxa-9,10-diboratetracyclo[8.2.1.16,9.02,4]tetradecane |
|---|---|
| PubChem CID | 144679836 |
| Molecular Formula | C14H24B2O4 |
| Molecular Weight | 277.97 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (2S)-1,6,7,7,12,12-hexamethyl-8,11,13,14-tetraoxa-9,10-diboratetracyclo[8.2.1.16,9.02,4]tetradecane |
| SMILES | CC1(C)OB2OC1(C)CC1C[C@@H]1C1(C)OB2OC1(C)C |
| InChI | InChI=1S/C14H24B2O4/c1-11(2)13(5)8-9-7-10(9)14(6)12(3,4)18-16(20-14)15(17-11)19-13/h9-10H,7-8H2,1-6H3/t9?,10-,13?,14?/m0/s1 |
| InChIKey | DTHKGOGYNMAADX-HYAMIDOJSA-N |
| XLogP | 2.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.97 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|