C26H22FN3O3S — CID 144679853
3-[5-(15-fluoro-8-oxa-3,10-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),3,5,11(16),12,14-heptaen-4-yl)-2-methoxy-4-[methyl(sulfanyl)amino]phenyl]but-3-en-2-one (PubChem CID 144679853) has the molecular formula C26H22FN3O3S and a molecular weight of 475.55 g/mol. Its IUPAC name is 3-[5-(15-fluoro-8-oxa-3,10-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),3,5,11(16),12,14-heptaen-4-yl)-2-methoxy-4-[methyl(sulfanyl)amino]phenyl]but-3-en-2-one.
| Compound Name | 3-[5-(15-fluoro-8-oxa-3,10-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),3,5,11(16),12,14-heptaen-4-yl)-2-methoxy-4-[methyl(sulfanyl)amino]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 144679853 |
| Molecular Formula | C26H22FN3O3S |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 3-[5-(15-fluoro-8-oxa-3,10-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),3,5,11(16),12,14-heptaen-4-yl)-2-methoxy-4-[methyl(sulfanyl)amino]phenyl]but-3-en-2-one |
| SMILES | C=C(C(C)=O)c1cc(-c2ccc3c(n2)-c2cc4c(F)cccc4n2CO3)c(N(C)S)cc1OC |
| InChI | InChI=1S/C26H22FN3O3S/c1-14(15(2)31)16-10-18(22(29(3)34)12-25(16)32-4)20-8-9-24-26(28-20)23-11-17-19(27)6-5-7-21(17)30(23)13-33-24/h5-12,34H,1,13H2,2-4H3 |
| InChIKey | CGTKXBCELSMRLV-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|