C13H18O4 — CID 144680750
oxan-2-yl (3Z)-5-methoxy-2-methylidenehexa-3,5-dienoate (PubChem CID 144680750) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is oxan-2-yl (3Z)-5-methoxy-2-methylidenehexa-3,5-dienoate.
| Compound Name | oxan-2-yl (3Z)-5-methoxy-2-methylidenehexa-3,5-dienoate |
|---|---|
| PubChem CID | 144680750 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | oxan-2-yl (3Z)-5-methoxy-2-methylidenehexa-3,5-dienoate |
| SMILES | C=C(/C=C\C(=C)C(=O)OC1CCCCO1)OC |
| InChI | InChI=1S/C13H18O4/c1-10(7-8-11(2)15-3)13(14)17-12-6-4-5-9-16-12/h7-8,12H,1-2,4-6,9H2,3H3/b8-7- |
| InChIKey | BAGUFMKJADCVCN-FPLPWBNLSA-N |
| XLogP | 2.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|