About tri(propan-2-yl)silyl 2,2,2-trifluoroacetate
tri(propan-2-yl)silyl 2,2,2-trifluoroacetate (PubChem CID 14468081) has the molecular formula C11H21F3O2Si
and a molecular weight of 270.37 g/mol. Its IUPAC name is tri(propan-2-yl)silyl 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | tri(propan-2-yl)silyl 2,2,2-trifluoroacetate |
| PubChem CID | 14468081 |
| Molecular Formula | C11H21F3O2Si |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | tri(propan-2-yl)silyl 2,2,2-trifluoroacetate |
| SMILES | CC(C)[Si](OC(=O)C(F)(F)F)(C(C)C)C(C)C |
| InChI | InChI=1S/C11H21F3O2Si/c1-7(2)17(8(3)4,9(5)6)16-10(15)11(12,13)14/h7-9H,1-6H3 |
| InChIKey | FXCXOYWBBDHGSX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tri(propan-2-yl)silyl 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tri(propan-2-yl)silyl 2,2,2-trifluoroacetate?
The IUPAC name of tri(propan-2-yl)silyl 2,2,2-trifluoroacetate (CID 14468081) is tri(propan-2-yl)silyl 2,2,2-trifluoroacetate.
What is the SMILES notation for tri(propan-2-yl)silyl 2,2,2-trifluoroacetate?
The canonical SMILES for tri(propan-2-yl)silyl 2,2,2-trifluoroacetate is CC(C)[Si](OC(=O)C(F)(F)F)(C(C)C)C(C)C.
What is the InChIKey of tri(propan-2-yl)silyl 2,2,2-trifluoroacetate?
The InChIKey is FXCXOYWBBDHGSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F3O2Si/c1-7(2)17(8(3)4,9(5)6)16-10(15)11(12,13)14/h7-9H,1-6H3.
What are the key properties of tri(propan-2-yl)silyl 2,2,2-trifluoroacetate?
tri(propan-2-yl)silyl 2,2,2-trifluoroacetate has a molecular weight of 270.37 g/mol, XLogP of 4.27, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tri(propan-2-yl)silyl 2,2,2-trifluoroacetate is sourced from PubChem (CID 14468081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).