C20H25FN4OS — CID 144680919
(13-cyclohexyl-11-cyclopropyl-10-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-5-yl) thiohypofluorite;ethene (PubChem CID 144680919) has the molecular formula C20H25FN4OS and a molecular weight of 388.51 g/mol. Its IUPAC name is (13-cyclohexyl-11-cyclopropyl-10-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-5-yl) thiohypofluorite;ethene.
| Compound Name | (13-cyclohexyl-11-cyclopropyl-10-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-5-yl) thiohypofluorite;ethene |
|---|---|
| PubChem CID | 144680919 |
| Molecular Formula | C20H25FN4OS |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (13-cyclohexyl-11-cyclopropyl-10-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-5-yl) thiohypofluorite;ethene |
| SMILES | C=C.O=C1c2cnc3c(ccn3SF)c2N(C2CCCCC2)CN1C1CC1 |
| InChI | InChI=1S/C18H21FN4OS.C2H4/c19-25-23-9-8-14-16-15(10-20-17(14)23)18(24)22(13-6-7-13)11-21(16)12-4-2-1-3-5-12;1-2/h8-10,12-13H,1-7,11H2;1-2H2 |
| InChIKey | CSZPDVJSXNITNA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|