C22H26F4N6OS — CID 144680936
[11-(cyanomethyl)-13-cyclohexyl-10-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-5-yl] thiohypofluorite;N-methyl-1-(trifluoromethyl)cyclopropan-1-amine (PubChem CID 144680936) has the molecular formula C22H26F4N6OS and a molecular weight of 498.55 g/mol. Its IUPAC name is [11-(cyanomethyl)-13-cyclohexyl-10-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-5-yl] thiohypofluorite;N-methyl-1-(trifluoromethyl)cyclopropan-1-amine.
| Compound Name | [11-(cyanomethyl)-13-cyclohexyl-10-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-5-yl] thiohypofluorite;N-methyl-1-(trifluoromethyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 144680936 |
| Molecular Formula | C22H26F4N6OS |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | [11-(cyanomethyl)-13-cyclohexyl-10-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-5-yl] thiohypofluorite;N-methyl-1-(trifluoromethyl)cyclopropan-1-amine |
| SMILES | CNC1(C(F)(F)F)CC1.N#CCN1CN(C2CCCCC2)c2c(cnc3c2ccn3SF)C1=O |
| InChI | InChI=1S/C17H18FN5OS.C5H8F3N/c18-25-23-8-6-13-15-14(10-20-16(13)23)17(24)21(9-7-19)11-22(15)12-4-2-1-3-5-12;1-9-4(2-3-4)5(6,7)8/h6,8,10,12H,1-5,9,11H2;9H,2-3H2,1H3 |
| InChIKey | ILQBMZZCSQSJDY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 77.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|