C28H23ClN2 — CID 144681337
2-chloro-4-[4-[3-[(3Z,5Z)-octa-3,5,7-trien-2-yl]phenyl]phenyl]quinazoline (PubChem CID 144681337) has the molecular formula C28H23ClN2 and a molecular weight of 422.96 g/mol. Its IUPAC name is 2-chloro-4-[4-[3-[(3Z,5Z)-octa-3,5,7-trien-2-yl]phenyl]phenyl]quinazoline.
| Compound Name | 2-chloro-4-[4-[3-[(3Z,5Z)-octa-3,5,7-trien-2-yl]phenyl]phenyl]quinazoline |
|---|---|
| PubChem CID | 144681337 |
| Molecular Formula | C28H23ClN2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-chloro-4-[4-[3-[(3Z,5Z)-octa-3,5,7-trien-2-yl]phenyl]phenyl]quinazoline |
| SMILES | C=C/C=C\C=C/C(C)c1cccc(-c2ccc(-c3nc(Cl)nc4ccccc34)cc2)c1 |
| InChI | InChI=1S/C28H23ClN2/c1-3-4-5-6-10-20(2)23-11-9-12-24(19-23)21-15-17-22(18-16-21)27-25-13-7-8-14-26(25)30-28(29)31-27/h3-20H,1H2,2H3/b5-4-,10-6- |
| InChIKey | ZEEKBTVANPSGAJ-ARSRRCBKSA-N |
| XLogP | 8.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|