About [(4Z,5E)-5-prop-2-enylidene-4-propylidene-1H-pyrrol-2-yl]boronic acid
[(4Z,5E)-5-prop-2-enylidene-4-propylidene-1H-pyrrol-2-yl]boronic acid (PubChem CID 144681634) has the molecular formula C10H14BNO2
and a molecular weight of 191.04 g/mol. Its IUPAC name is [(4Z,5E)-5-prop-2-enylidene-4-propylidene-1H-pyrrol-2-yl]boronic acid.
Molecular Properties
| Compound Name | [(4Z,5E)-5-prop-2-enylidene-4-propylidene-1H-pyrrol-2-yl]boronic acid |
| PubChem CID | 144681634 |
| Molecular Formula | C10H14BNO2 |
| Molecular Weight | 191.04 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | [(4Z,5E)-5-prop-2-enylidene-4-propylidene-1H-pyrrol-2-yl]boronic acid |
| SMILES | C=C/C=c1/[nH]c(B(O)O)c/c1=C/CC |
| InChI | InChI=1S/C10H14BNO2/c1-3-5-8-7-10(11(13)14)12-9(8)6-4-2/h4-7,12-14H,2-3H2,1H3/b8-5-,9-6+ |
| InChIKey | BRUWFKLFYUQUBN-LDFAFZTOSA-N |
| XLogP | -1.15 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.04 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(4Z,5E)-5-prop-2-enylidene-4-propylidene-1H-pyrrol-2-yl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4Z,5E)-5-prop-2-enylidene-4-propylidene-1H-pyrrol-2-yl]boronic acid?
The IUPAC name of [(4Z,5E)-5-prop-2-enylidene-4-propylidene-1H-pyrrol-2-yl]boronic acid (CID 144681634) is [(4Z,5E)-5-prop-2-enylidene-4-propylidene-1H-pyrrol-2-yl]boronic acid.
What is the SMILES notation for [(4Z,5E)-5-prop-2-enylidene-4-propylidene-1H-pyrrol-2-yl]boronic acid?
The canonical SMILES for [(4Z,5E)-5-prop-2-enylidene-4-propylidene-1H-pyrrol-2-yl]boronic acid is C=C/C=c1/[nH]c(B(O)O)c/c1=C/CC.
What is the InChIKey of [(4Z,5E)-5-prop-2-enylidene-4-propylidene-1H-pyrrol-2-yl]boronic acid?
The InChIKey is BRUWFKLFYUQUBN-LDFAFZTOSA-N. The full InChI is InChI=1S/C10H14BNO2/c1-3-5-8-7-10(11(13)14)12-9(8)6-4-2/h4-7,12-14H,2-3H2,1H3/b8-5-,9-6+.
What are the key properties of [(4Z,5E)-5-prop-2-enylidene-4-propylidene-1H-pyrrol-2-yl]boronic acid?
[(4Z,5E)-5-prop-2-enylidene-4-propylidene-1H-pyrrol-2-yl]boronic acid has a molecular weight of 191.04 g/mol, XLogP of -1.15, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(4Z,5E)-5-prop-2-enylidene-4-propylidene-1H-pyrrol-2-yl]boronic acid is sourced from PubChem (CID 144681634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).