C32H37ClF3N7O5 — CID 144682164
prop-2-ynyl 12-chloro-20,20,31-trimethyl-23-oxo-5-(2,2,2-trifluoroethoxy)-14-oxa-2,4,6,8,18,22,31-heptazatetracyclo[22.2.2.210,13.13,7]hentriaconta-1(26),4,7,10,12,24,27,29-octaene-18-carboxylate (PubChem CID 144682164) has the molecular formula C32H37ClF3N7O5 and a molecular weight of 692.14 g/mol. Its IUPAC name is prop-2-ynyl 12-chloro-20,20,31-trimethyl-23-oxo-5-(2,2,2-trifluoroethoxy)-14-oxa-2,4,6,8,18,22,31-heptazatetracyclo[22.2.2.210,13.13,7]hentriaconta-1(26),4,7,10,12,24,27,29-octaene-18-carboxylate.
| Compound Name | prop-2-ynyl 12-chloro-20,20,31-trimethyl-23-oxo-5-(2,2,2-trifluoroethoxy)-14-oxa-2,4,6,8,18,22,31-heptazatetracyclo[22.2.2.210,13.13,7]hentriaconta-1(26),4,7,10,12,24,27,29-octaene-18-carboxylate |
|---|---|
| PubChem CID | 144682164 |
| Molecular Formula | C32H37ClF3N7O5 |
| Molecular Weight | 692.14 g/mol |
| Exact Mass | 691.25 |
| IUPAC Name | prop-2-ynyl 12-chloro-20,20,31-trimethyl-23-oxo-5-(2,2,2-trifluoroethoxy)-14-oxa-2,4,6,8,18,22,31-heptazatetracyclo[22.2.2.210,13.13,7]hentriaconta-1(26),4,7,10,12,24,27,29-octaene-18-carboxylate |
| SMILES | C#CCOC(=O)N1CCCOc2ccc(cc2Cl)C/N=C2/NC(OCC(F)(F)F)=NC(Nc3ccc(cc3)C(=O)NCC(C)(C)C1)N2C |
| InChI | InChI=1S/C32H37ClF3N7O5/c1-5-14-47-30(45)43-13-6-15-46-25-12-7-21(16-24(25)33)17-37-27-40-29(48-20-32(34,35)36)41-28(42(27)4)39-23-10-8-22(9-11-23)26(44)38-18-31(2,3)19-43/h1,7-12,16,28,39H,6,13-15,17-20H2,2-4H3,(H,38,44)(H,37,40,41) |
| InChIKey | BNYBRIGTVPVJSN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 129.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.14 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|