C20H29FO3 — CID 144682475
(11S)-18-fluoro-1-methoxy-16-methyltetracyclo[9.7.0.03,8.012,16]octadeca-2,14-diene-5,11-diol (PubChem CID 144682475) has the molecular formula C20H29FO3 and a molecular weight of 336.45 g/mol. Its IUPAC name is (11S)-18-fluoro-1-methoxy-16-methyltetracyclo[9.7.0.03,8.012,16]octadeca-2,14-diene-5,11-diol.
| Compound Name | (11S)-18-fluoro-1-methoxy-16-methyltetracyclo[9.7.0.03,8.012,16]octadeca-2,14-diene-5,11-diol |
|---|---|
| PubChem CID | 144682475 |
| Molecular Formula | C20H29FO3 |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (11S)-18-fluoro-1-methoxy-16-methyltetracyclo[9.7.0.03,8.012,16]octadeca-2,14-diene-5,11-diol |
| SMILES | COC12C=C3CC(O)CCC3CC[C@]1(O)C1CC=CC1(C)CC2F |
| InChI | InChI=1S/C20H29FO3/c1-18-8-3-4-16(18)19(23)9-7-13-5-6-15(22)10-14(13)11-20(19,24-2)17(21)12-18/h3,8,11,13,15-17,22-23H,4-7,9-10,12H2,1-2H3/t13?,15?,16?,17?,18?,19-,20?/m0/s1 |
| InChIKey | CAWJMJAGSZMTLD-UOIDUDQZSA-N |
| XLogP | 3.31 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|