C30H38N2O3 — CID 144682895
(11S)-5,11-dihydroxy-15-isoquinolin-7-yl-16-methyltetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-dien-14-one;N-methylmethanamine (PubChem CID 144682895) has the molecular formula C30H38N2O3 and a molecular weight of 474.65 g/mol. Its IUPAC name is (11S)-5,11-dihydroxy-15-isoquinolin-7-yl-16-methyltetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-dien-14-one;N-methylmethanamine.
| Compound Name | (11S)-5,11-dihydroxy-15-isoquinolin-7-yl-16-methyltetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-dien-14-one;N-methylmethanamine |
|---|---|
| PubChem CID | 144682895 |
| Molecular Formula | C30H38N2O3 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | (11S)-5,11-dihydroxy-15-isoquinolin-7-yl-16-methyltetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-dien-14-one;N-methylmethanamine |
| SMILES | CC12CC=C3C=C4CC(O)CCC4CC[C@]3(O)C1CC(=O)C2c1ccc2ccncc2c1.CNC |
| InChI | InChI=1S/C28H31NO3.C2H7N/c1-27-9-7-22-13-20-14-23(30)5-4-17(20)6-10-28(22,32)25(27)15-24(31)26(27)19-3-2-18-8-11-29-16-21(18)12-19;1-3-2/h2-3,7-8,11-13,16-17,23,25-26,30,32H,4-6,9-10,14-15H2,1H3;3H,1-2H3/t17?,23?,25?,26?,27?,28-;/m1./s1 |
| InChIKey | IJUGHGXKRSDXRV-UCVJRYMMSA-N |
| XLogP | 4.69 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |