C27H38FN3O3 — CID 144682908
(11S)-1-fluoro-5,11-dihydroxy-16-methyl-N-pyridin-3-yltetracyclo[9.7.0.03,8.012,16]octadeca-2,14-diene-15-carboxamide;N-methylmethanamine (PubChem CID 144682908) has the molecular formula C27H38FN3O3 and a molecular weight of 471.62 g/mol. Its IUPAC name is (11S)-1-fluoro-5,11-dihydroxy-16-methyl-N-pyridin-3-yltetracyclo[9.7.0.03,8.012,16]octadeca-2,14-diene-15-carboxamide;N-methylmethanamine.
| Compound Name | (11S)-1-fluoro-5,11-dihydroxy-16-methyl-N-pyridin-3-yltetracyclo[9.7.0.03,8.012,16]octadeca-2,14-diene-15-carboxamide;N-methylmethanamine |
|---|---|
| PubChem CID | 144682908 |
| Molecular Formula | C27H38FN3O3 |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | (11S)-1-fluoro-5,11-dihydroxy-16-methyl-N-pyridin-3-yltetracyclo[9.7.0.03,8.012,16]octadeca-2,14-diene-15-carboxamide;N-methylmethanamine |
| SMILES | CC12CCC3(F)C=C4CC(O)CCC4CC[C@]3(O)C1CC=C2C(=O)Nc1cccnc1.CNC |
| InChI | InChI=1S/C25H31FN2O3.C2H7N/c1-23-10-11-24(26)14-17-13-19(29)5-4-16(17)8-9-25(24,31)21(23)7-6-20(23)22(30)28-18-3-2-12-27-15-18;1-3-2/h2-3,6,12,14-16,19,21,29,31H,4-5,7-11,13H2,1H3,(H,28,30);3H,1-2H3/t16?,19?,21?,23?,24?,25-;/m0./s1 |
| InChIKey | VHTRQVICFHGMFQ-ZMXRATCXSA-N |
| XLogP | 3.92 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|